C10H11ClF3NO2S — CID 104556498
N-(1-chloropropan-2-yl)-2,4,6-trifluoro-N-methylbenzenesulfonamide (PubChem CID 104556498) has the molecular formula C10H11ClF3NO2S and a molecular weight of 301.72 g/mol. Its IUPAC name is N-(1-chloropropan-2-yl)-2,4,6-trifluoro-N-methylbenzenesulfonamide.
| Compound Name | N-(1-chloropropan-2-yl)-2,4,6-trifluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 104556498 |
| Molecular Formula | C10H11ClF3NO2S |
| Molecular Weight | 301.72 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | N-(1-chloropropan-2-yl)-2,4,6-trifluoro-N-methylbenzenesulfonamide |
| SMILES | CC(CCl)N(C)S(=O)(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C10H11ClF3NO2S/c1-6(5-11)15(2)18(16,17)10-8(13)3-7(12)4-9(10)14/h3-4,6H,5H2,1-2H3 |
| InChIKey | SCQHUTKDSKMIEO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.72 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|