C11H20N2O2S3 — CID 112667445
N-methyl-2-(methylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)thiophene-3-sulfonamide (PubChem CID 112667445) has the molecular formula C11H20N2O2S3 and a molecular weight of 308.49 g/mol. Its IUPAC name is N-methyl-2-(methylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)thiophene-3-sulfonamide.
| Compound Name | N-methyl-2-(methylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 112667445 |
| Molecular Formula | C11H20N2O2S3 |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | N-methyl-2-(methylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)thiophene-3-sulfonamide |
| SMILES | CNCc1sccc1S(=O)(=O)N(C)C(C)CSC |
| InChI | InChI=1S/C11H20N2O2S3/c1-9(8-16-4)13(3)18(14,15)11-5-6-17-10(11)7-12-2/h5-6,9,12H,7-8H2,1-4H3 |
| InChIKey | MJWZBHZDGSGLBK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |