C13H23N3O3S2 — CID 106324582
N,N-dimethyl-5-[(2-thiomorpholin-4-ylethylamino)methyl]furan-2-sulfonamide (PubChem CID 106324582) has the molecular formula C13H23N3O3S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is N,N-dimethyl-5-[(2-thiomorpholin-4-ylethylamino)methyl]furan-2-sulfonamide.
| Compound Name | N,N-dimethyl-5-[(2-thiomorpholin-4-ylethylamino)methyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 106324582 |
| Molecular Formula | C13H23N3O3S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N,N-dimethyl-5-[(2-thiomorpholin-4-ylethylamino)methyl]furan-2-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(CNCCN2CCSCC2)o1 |
| InChI | InChI=1S/C13H23N3O3S2/c1-15(2)21(17,18)13-4-3-12(19-13)11-14-5-6-16-7-9-20-10-8-16/h3-4,14H,5-11H2,1-2H3 |
| InChIKey | ZGJZFSWPNJIDQR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|