C10H17N3OS — CID 106325045
N-(1,3-oxazol-5-ylmethyl)-2-thiomorpholin-4-ylethanamine (PubChem CID 106325045) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is N-(1,3-oxazol-5-ylmethyl)-2-thiomorpholin-4-ylethanamine.
| Compound Name | N-(1,3-oxazol-5-ylmethyl)-2-thiomorpholin-4-ylethanamine |
|---|---|
| PubChem CID | 106325045 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-(1,3-oxazol-5-ylmethyl)-2-thiomorpholin-4-ylethanamine |
| SMILES | c1ncc(CNCCN2CCSCC2)o1 |
| InChI | InChI=1S/C10H17N3OS/c1(2-13-3-5-15-6-4-13)11-7-10-8-12-9-14-10/h8-9,11H,1-7H2 |
| InChIKey | CVUUUMFTEINFHV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|