C13H25N5S — CID 106324569
N,N,1-trimethyl-5-[(2-thiomorpholin-4-ylethylamino)methyl]imidazol-2-amine (PubChem CID 106324569) has the molecular formula C13H25N5S and a molecular weight of 283.44 g/mol. Its IUPAC name is N,N,1-trimethyl-5-[(2-thiomorpholin-4-ylethylamino)methyl]imidazol-2-amine.
| Compound Name | N,N,1-trimethyl-5-[(2-thiomorpholin-4-ylethylamino)methyl]imidazol-2-amine |
|---|---|
| PubChem CID | 106324569 |
| Molecular Formula | C13H25N5S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | N,N,1-trimethyl-5-[(2-thiomorpholin-4-ylethylamino)methyl]imidazol-2-amine |
| SMILES | CN(C)c1ncc(CNCCN2CCSCC2)n1C |
| InChI | InChI=1S/C13H25N5S/c1-16(2)13-15-11-12(17(13)3)10-14-4-5-18-6-8-19-9-7-18/h11,14H,4-10H2,1-3H3 |
| InChIKey | SZHKIYFCGIVUGM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|