C13H22N6 — CID 80682636
N,N,1-trimethyl-5-[[2-(1-methylpyrazol-4-yl)ethylamino]methyl]imidazol-2-amine (PubChem CID 80682636) has the molecular formula C13H22N6 and a molecular weight of 262.36 g/mol. Its IUPAC name is N,N,1-trimethyl-5-[[2-(1-methylpyrazol-4-yl)ethylamino]methyl]imidazol-2-amine.
| Compound Name | N,N,1-trimethyl-5-[[2-(1-methylpyrazol-4-yl)ethylamino]methyl]imidazol-2-amine |
|---|---|
| PubChem CID | 80682636 |
| Molecular Formula | C13H22N6 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | N,N,1-trimethyl-5-[[2-(1-methylpyrazol-4-yl)ethylamino]methyl]imidazol-2-amine |
| SMILES | CN(C)c1ncc(CNCCc2cnn(C)c2)n1C |
| InChI | InChI=1S/C13H22N6/c1-17(2)13-15-9-12(19(13)4)8-14-6-5-11-7-16-18(3)10-11/h7,9-10,14H,5-6,8H2,1-4H3 |
| InChIKey | ZEWIYYSFLYKOLZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|