C11H20N4 — CID 114615401
N,N,1-trimethyl-5-[(2-methylprop-2-enylamino)methyl]imidazol-2-amine (PubChem CID 114615401) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is N,N,1-trimethyl-5-[(2-methylprop-2-enylamino)methyl]imidazol-2-amine.
| Compound Name | N,N,1-trimethyl-5-[(2-methylprop-2-enylamino)methyl]imidazol-2-amine |
|---|---|
| PubChem CID | 114615401 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N,N,1-trimethyl-5-[(2-methylprop-2-enylamino)methyl]imidazol-2-amine |
| SMILES | C=C(C)CNCc1cnc(N(C)C)n1C |
| InChI | InChI=1S/C11H20N4/c1-9(2)6-12-7-10-8-13-11(14(3)4)15(10)5/h8,12H,1,6-7H2,2-5H3 |
| InChIKey | AGLYXTUGDGZQPX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|