C14H20F2N2S — CID 106324814
N-[[3-(difluoromethyl)phenyl]methyl]-2-thiomorpholin-4-ylethanamine (PubChem CID 106324814) has the molecular formula C14H20F2N2S and a molecular weight of 286.39 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)phenyl]methyl]-2-thiomorpholin-4-ylethanamine.
| Compound Name | N-[[3-(difluoromethyl)phenyl]methyl]-2-thiomorpholin-4-ylethanamine |
|---|---|
| PubChem CID | 106324814 |
| Molecular Formula | C14H20F2N2S |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-[[3-(difluoromethyl)phenyl]methyl]-2-thiomorpholin-4-ylethanamine |
| SMILES | FC(F)c1cccc(CNCCN2CCSCC2)c1 |
| InChI | InChI=1S/C14H20F2N2S/c15-14(16)13-3-1-2-12(10-13)11-17-4-5-18-6-8-19-9-7-18/h1-3,10,14,17H,4-9,11H2 |
| InChIKey | BBYZEZKHNONWKG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|