C14H17F2N3S — CID 107166306
3,5-difluoro-4-[(2-thiomorpholin-4-ylethylamino)methyl]benzonitrile (PubChem CID 107166306) has the molecular formula C14H17F2N3S and a molecular weight of 297.37 g/mol. Its IUPAC name is 3,5-difluoro-4-[(2-thiomorpholin-4-ylethylamino)methyl]benzonitrile.
| Compound Name | 3,5-difluoro-4-[(2-thiomorpholin-4-ylethylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 107166306 |
| Molecular Formula | C14H17F2N3S |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3,5-difluoro-4-[(2-thiomorpholin-4-ylethylamino)methyl]benzonitrile |
| SMILES | N#Cc1cc(F)c(CNCCN2CCSCC2)c(F)c1 |
| InChI | InChI=1S/C14H17F2N3S/c15-13-7-11(9-17)8-14(16)12(13)10-18-1-2-19-3-5-20-6-4-19/h7-8,18H,1-6,10H2 |
| InChIKey | YUKNLBSYNULYEN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|