C14H14F2N4 — CID 107038646
3,5-difluoro-4-[[2-(1-methylpyrazol-4-yl)ethylamino]methyl]benzonitrile (PubChem CID 107038646) has the molecular formula C14H14F2N4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 3,5-difluoro-4-[[2-(1-methylpyrazol-4-yl)ethylamino]methyl]benzonitrile.
| Compound Name | 3,5-difluoro-4-[[2-(1-methylpyrazol-4-yl)ethylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 107038646 |
| Molecular Formula | C14H14F2N4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3,5-difluoro-4-[[2-(1-methylpyrazol-4-yl)ethylamino]methyl]benzonitrile |
| SMILES | Cn1cc(CCNCc2c(F)cc(C#N)cc2F)cn1 |
| InChI | InChI=1S/C14H14F2N4/c1-20-9-10(7-19-20)2-3-18-8-12-13(15)4-11(6-17)5-14(12)16/h4-5,7,9,18H,2-3,8H2,1H3 |
| InChIKey | JVCNJHLTPHWQLO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|