C16H21F2N3 — CID 107038139
3,5-difluoro-4-[[2-(4-methylpiperidin-1-yl)ethylamino]methyl]benzonitrile (PubChem CID 107038139) has the molecular formula C16H21F2N3 and a molecular weight of 293.36 g/mol. Its IUPAC name is 3,5-difluoro-4-[[2-(4-methylpiperidin-1-yl)ethylamino]methyl]benzonitrile.
| Compound Name | 3,5-difluoro-4-[[2-(4-methylpiperidin-1-yl)ethylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 107038139 |
| Molecular Formula | C16H21F2N3 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 3,5-difluoro-4-[[2-(4-methylpiperidin-1-yl)ethylamino]methyl]benzonitrile |
| SMILES | CC1CCN(CCNCc2c(F)cc(C#N)cc2F)CC1 |
| InChI | InChI=1S/C16H21F2N3/c1-12-2-5-21(6-3-12)7-4-20-11-14-15(17)8-13(10-19)9-16(14)18/h8-9,12,20H,2-7,11H2,1H3 |
| InChIKey | PKCWDHWJDCLIJU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|