C17H28N4 — CID 115573354
1,5-dimethyl-4-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]pyrrole-2-carbonitrile (PubChem CID 115573354) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is 1,5-dimethyl-4-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]pyrrole-2-carbonitrile.
| Compound Name | 1,5-dimethyl-4-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 115573354 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 1,5-dimethyl-4-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]pyrrole-2-carbonitrile |
| SMILES | Cc1c(CNCCCN2CCC(C)CC2)cc(C#N)n1C |
| InChI | InChI=1S/C17H28N4/c1-14-5-9-21(10-6-14)8-4-7-19-13-16-11-17(12-18)20(3)15(16)2/h11,14,19H,4-10,13H2,1-3H3 |
| InChIKey | SQHRCNFQZYVHGN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|