C14H21N3O — CID 113222755
1,5-dimethyl-4-[[2-(oxolan-2-yl)ethylamino]methyl]pyrrole-2-carbonitrile (PubChem CID 113222755) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 1,5-dimethyl-4-[[2-(oxolan-2-yl)ethylamino]methyl]pyrrole-2-carbonitrile.
| Compound Name | 1,5-dimethyl-4-[[2-(oxolan-2-yl)ethylamino]methyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 113222755 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1,5-dimethyl-4-[[2-(oxolan-2-yl)ethylamino]methyl]pyrrole-2-carbonitrile |
| SMILES | Cc1c(CNCCC2CCCO2)cc(C#N)n1C |
| InChI | InChI=1S/C14H21N3O/c1-11-12(8-13(9-15)17(11)2)10-16-6-5-14-4-3-7-18-14/h8,14,16H,3-7,10H2,1-2H3 |
| InChIKey | RKCXZSSDUVINRD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|