C16H24N4O — CID 115584427
1,5-dimethyl-4-[[(3-oxo-3-piperidin-1-ylpropyl)amino]methyl]pyrrole-2-carbonitrile (PubChem CID 115584427) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 1,5-dimethyl-4-[[(3-oxo-3-piperidin-1-ylpropyl)amino]methyl]pyrrole-2-carbonitrile.
| Compound Name | 1,5-dimethyl-4-[[(3-oxo-3-piperidin-1-ylpropyl)amino]methyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 115584427 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 1,5-dimethyl-4-[[(3-oxo-3-piperidin-1-ylpropyl)amino]methyl]pyrrole-2-carbonitrile |
| SMILES | Cc1c(CNCCC(=O)N2CCCCC2)cc(C#N)n1C |
| InChI | InChI=1S/C16H24N4O/c1-13-14(10-15(11-17)19(13)2)12-18-7-6-16(21)20-8-4-3-5-9-20/h10,18H,3-9,12H2,1-2H3 |
| InChIKey | IBINZNIGEIQOTB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|