C13H21F2NO2S — CID 103859480
5-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]-2-methylpentan-1-ol (PubChem CID 103859480) has the molecular formula C13H21F2NO2S and a molecular weight of 293.38 g/mol. Its IUPAC name is 5-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]-2-methylpentan-1-ol.
| Compound Name | 5-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 103859480 |
| Molecular Formula | C13H21F2NO2S |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 5-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]-2-methylpentan-1-ol |
| SMILES | CC(CO)CCCNCc1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C13H21F2NO2S/c1-10(8-17)3-2-6-16-7-11-4-5-12(18-11)9-19-13(14)15/h4-5,10,13,16-17H,2-3,6-9H2,1H3 |
| InChIKey | ABMCMIDGKOOOBN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|