C11H17F2NO2S2 — CID 113237595
N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-ethylsulfinylethanamine (PubChem CID 113237595) has the molecular formula C11H17F2NO2S2 and a molecular weight of 297.39 g/mol. Its IUPAC name is N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-ethylsulfinylethanamine.
| Compound Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-ethylsulfinylethanamine |
|---|---|
| PubChem CID | 113237595 |
| Molecular Formula | C11H17F2NO2S2 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-ethylsulfinylethanamine |
| SMILES | CCS(=O)CCNCc1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C11H17F2NO2S2/c1-2-18(15)6-5-14-7-9-3-4-10(16-9)8-17-11(12)13/h3-4,11,14H,2,5-8H2,1H3 |
| InChIKey | GIRRALBLXZFSHP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|