C13H21F2NOS — CID 113237061
N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-3-methylpentan-3-amine (PubChem CID 113237061) has the molecular formula C13H21F2NOS and a molecular weight of 277.38 g/mol. Its IUPAC name is N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-3-methylpentan-3-amine.
| Compound Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-3-methylpentan-3-amine |
|---|---|
| PubChem CID | 113237061 |
| Molecular Formula | C13H21F2NOS |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-3-methylpentan-3-amine |
| SMILES | CCC(C)(CC)NCc1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C13H21F2NOS/c1-4-13(3,5-2)16-8-10-6-7-11(17-10)9-18-12(14)15/h6-7,12,16H,4-5,8-9H2,1-3H3 |
| InChIKey | QWRUFPFCOXJNGK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |