C14H18N4O5S — CID 55998995
[5-(dimethylsulfamoyl)furan-2-yl]methyl 3-(pyrimidin-2-ylamino)propanoate (PubChem CID 55998995) has the molecular formula C14H18N4O5S and a molecular weight of 354.39 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)furan-2-yl]methyl 3-(pyrimidin-2-ylamino)propanoate.
| Compound Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 3-(pyrimidin-2-ylamino)propanoate |
|---|---|
| PubChem CID | 55998995 |
| Molecular Formula | C14H18N4O5S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 3-(pyrimidin-2-ylamino)propanoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(COC(=O)CCNc2ncccn2)o1 |
| InChI | InChI=1S/C14H18N4O5S/c1-18(2)24(20,21)13-5-4-11(23-13)10-22-12(19)6-9-17-14-15-7-3-8-16-14/h3-5,7-8H,6,9-10H2,1-2H3,(H,15,16,17) |
| InChIKey | HFCLVKXPUZVCEV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |