C15H14F3NO5S — CID 55730864
[5-(dimethylsulfamoyl)furan-2-yl]methyl 2-(trifluoromethyl)benzoate (PubChem CID 55730864) has the molecular formula C15H14F3NO5S and a molecular weight of 377.34 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-(trifluoromethyl)benzoate.
| Compound Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 55730864 |
| Molecular Formula | C15H14F3NO5S |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-(trifluoromethyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(COC(=O)c2ccccc2C(F)(F)F)o1 |
| InChI | InChI=1S/C15H14F3NO5S/c1-19(2)25(21,22)13-8-7-10(24-13)9-23-14(20)11-5-3-4-6-12(11)15(16,17)18/h3-8H,9H2,1-2H3 |
| InChIKey | ORCGARAWLPSQHX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |