C14H12ClF2NO5S — CID 55733852
[5-(dimethylsulfamoyl)furan-2-yl]methyl 2-chloro-4,5-difluorobenzoate (PubChem CID 55733852) has the molecular formula C14H12ClF2NO5S and a molecular weight of 379.77 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-chloro-4,5-difluorobenzoate.
| Compound Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 55733852 |
| Molecular Formula | C14H12ClF2NO5S |
| Molecular Weight | 379.77 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-chloro-4,5-difluorobenzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(COC(=O)c2cc(F)c(F)cc2Cl)o1 |
| InChI | InChI=1S/C14H12ClF2NO5S/c1-18(2)24(20,21)13-4-3-8(23-13)7-22-14(19)9-5-11(16)12(17)6-10(9)15/h3-6H,7H2,1-2H3 |
| InChIKey | JFRRBVCISMQWGQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.77 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|