C16H19NO7S — CID 55730705
[5-(dimethylsulfamoyl)furan-2-yl]methyl 2,4-dimethoxybenzoate (PubChem CID 55730705) has the molecular formula C16H19NO7S and a molecular weight of 369.40 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)furan-2-yl]methyl 2,4-dimethoxybenzoate.
| Compound Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 55730705 |
| Molecular Formula | C16H19NO7S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 2,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCc2ccc(S(=O)(=O)N(C)C)o2)c(OC)c1 |
| InChI | InChI=1S/C16H19NO7S/c1-17(2)25(19,20)15-8-6-12(24-15)10-23-16(18)13-7-5-11(21-3)9-14(13)22-4/h5-9H,10H2,1-4H3 |
| InChIKey | LMBFINJOJXCZKO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |