C16H19NO7S2 — CID 55730894
[5-(dimethylsulfamoyl)furan-2-yl]methyl 4-(methylsulfonylmethyl)benzoate (PubChem CID 55730894) has the molecular formula C16H19NO7S2 and a molecular weight of 401.46 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)furan-2-yl]methyl 4-(methylsulfonylmethyl)benzoate.
| Compound Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 4-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 55730894 |
| Molecular Formula | C16H19NO7S2 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 4-(methylsulfonylmethyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(COC(=O)c2ccc(CS(C)(=O)=O)cc2)o1 |
| InChI | InChI=1S/C16H19NO7S2/c1-17(2)26(21,22)15-9-8-14(24-15)10-23-16(18)13-6-4-12(5-7-13)11-25(3,19)20/h4-9H,10-11H2,1-3H3 |
| InChIKey | QKQGXKHSUPQLDM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 110.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |