C20H26N2O7S2 — CID 55730756
[5-(dimethylsulfamoyl)furan-2-yl]methyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 55730756) has the molecular formula C20H26N2O7S2 and a molecular weight of 470.57 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)furan-2-yl]methyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55730756 |
| Molecular Formula | C20H26N2O7S2 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C(=O)OCc2ccc(S(=O)(=O)N(C)C)o2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H26N2O7S2/c1-15-7-8-16(13-18(15)30(24,25)22-11-5-4-6-12-22)20(23)28-14-17-9-10-19(29-17)31(26,27)21(2)3/h7-10,13H,4-6,11-12,14H2,1-3H3 |
| InChIKey | GKOQVFBFDSBXFO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |