C23H24N2O5S — CID 16528609
(5-phenyl-1,3-oxazol-2-yl)methyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 16528609) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16528609 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C(=O)OCc2ncc(-c3ccccc3)o2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C23H24N2O5S/c1-17-10-11-19(14-21(17)31(27,28)25-12-6-3-7-13-25)23(26)29-16-22-24-15-20(30-22)18-8-4-2-5-9-18/h2,4-5,8-11,14-15H,3,6-7,12-13,16H2,1H3 |
| InChIKey | JNYHUZNJSVOKNK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |