C20H19NO6S — CID 55730810
[5-(dimethylsulfamoyl)furan-2-yl]methyl 2-phenoxybenzoate (PubChem CID 55730810) has the molecular formula C20H19NO6S and a molecular weight of 401.44 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-phenoxybenzoate.
| Compound Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-phenoxybenzoate |
|---|---|
| PubChem CID | 55730810 |
| Molecular Formula | C20H19NO6S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-phenoxybenzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(COC(=O)c2ccccc2Oc2ccccc2)o1 |
| InChI | InChI=1S/C20H19NO6S/c1-21(2)28(23,24)19-13-12-16(27-19)14-25-20(22)17-10-6-7-11-18(17)26-15-8-4-3-5-9-15/h3-13H,14H2,1-2H3 |
| InChIKey | AUEBLBJBWOGYKU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |