C18H22BrNO7S — CID 55730566
[5-(dimethylsulfamoyl)furan-2-yl]methyl 3-bromo-5-methoxy-4-propoxybenzoate (PubChem CID 55730566) has the molecular formula C18H22BrNO7S and a molecular weight of 476.35 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)furan-2-yl]methyl 3-bromo-5-methoxy-4-propoxybenzoate.
| Compound Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 3-bromo-5-methoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 55730566 |
| Molecular Formula | C18H22BrNO7S |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 3-bromo-5-methoxy-4-propoxybenzoate |
| SMILES | CCCOc1c(Br)cc(C(=O)OCc2ccc(S(=O)(=O)N(C)C)o2)cc1OC |
| InChI | InChI=1S/C18H22BrNO7S/c1-5-8-25-17-14(19)9-12(10-15(17)24-4)18(21)26-11-13-6-7-16(27-13)28(22,23)20(2)3/h6-7,9-10H,5,8,11H2,1-4H3 |
| InChIKey | QKTCILWJHIZLGN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |