C17H22N2O7S2 — CID 55730896
[5-(dimethylsulfamoyl)furan-2-yl]methyl 5-(ethylsulfamoyl)-2-methylbenzoate (PubChem CID 55730896) has the molecular formula C17H22N2O7S2 and a molecular weight of 430.50 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)furan-2-yl]methyl 5-(ethylsulfamoyl)-2-methylbenzoate.
| Compound Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 5-(ethylsulfamoyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 55730896 |
| Molecular Formula | C17H22N2O7S2 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 5-(ethylsulfamoyl)-2-methylbenzoate |
| SMILES | CCNS(=O)(=O)c1ccc(C)c(C(=O)OCc2ccc(S(=O)(=O)N(C)C)o2)c1 |
| InChI | InChI=1S/C17H22N2O7S2/c1-5-18-27(21,22)14-8-6-12(2)15(10-14)17(20)25-11-13-7-9-16(26-13)28(23,24)19(3)4/h6-10,18H,5,11H2,1-4H3 |
| InChIKey | YPIDLRFMSXVVNK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |