C19H24N2O6S2 — CID 42986561
[3-(dimethylsulfamoyl)phenyl]methyl 5-(dimethylsulfamoyl)-2-methylbenzoate (PubChem CID 42986561) has the molecular formula C19H24N2O6S2 and a molecular weight of 440.54 g/mol. Its IUPAC name is [3-(dimethylsulfamoyl)phenyl]methyl 5-(dimethylsulfamoyl)-2-methylbenzoate.
| Compound Name | [3-(dimethylsulfamoyl)phenyl]methyl 5-(dimethylsulfamoyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 42986561 |
| Molecular Formula | C19H24N2O6S2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | [3-(dimethylsulfamoyl)phenyl]methyl 5-(dimethylsulfamoyl)-2-methylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1C(=O)OCc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C19H24N2O6S2/c1-14-9-10-17(29(25,26)21(4)5)12-18(14)19(22)27-13-15-7-6-8-16(11-15)28(23,24)20(2)3/h6-12H,13H2,1-5H3 |
| InChIKey | KKEWCYOLUGQTPT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |