C21H26N2O4S — CID 2626484
(4-methylphenyl)methyl 5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzoate (PubChem CID 2626484) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is (4-methylphenyl)methyl 5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzoate.
| Compound Name | (4-methylphenyl)methyl 5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 2626484 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (4-methylphenyl)methyl 5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzoate |
| SMILES | Cc1ccc(COC(=O)c2cc(S(=O)(=O)N(C)C)ccc2N2CCCC2)cc1 |
| InChI | InChI=1S/C21H26N2O4S/c1-16-6-8-17(9-7-16)15-27-21(24)19-14-18(28(25,26)22(2)3)10-11-20(19)23-12-4-5-13-23/h6-11,14H,4-5,12-13,15H2,1-3H3 |
| InChIKey | CTAQXGIYADLSSD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |