C23H31N3O4S — CID 55364063
5-(dimethylsulfamoyl)-N-[(4-methoxyphenyl)methyl]-N-methyl-2-piperidin-1-ylbenzamide (PubChem CID 55364063) has the molecular formula C23H31N3O4S and a molecular weight of 445.59 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-[(4-methoxyphenyl)methyl]-N-methyl-2-piperidin-1-ylbenzamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-[(4-methoxyphenyl)methyl]-N-methyl-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55364063 |
| Molecular Formula | C23H31N3O4S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-[(4-methoxyphenyl)methyl]-N-methyl-2-piperidin-1-ylbenzamide |
| SMILES | COc1ccc(CN(C)C(=O)c2cc(S(=O)(=O)N(C)C)ccc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H31N3O4S/c1-24(2)31(28,29)20-12-13-22(26-14-6-5-7-15-26)21(16-20)23(27)25(3)17-18-8-10-19(30-4)11-9-18/h8-13,16H,5-7,14-15,17H2,1-4H3 |
| InChIKey | DHGJYBBIHKLVJG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |