C22H29N3O5S — CID 30274722
N-(2,4-dimethoxyphenyl)-5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzamide (PubChem CID 30274722) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 30274722 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzamide |
| SMILES | COc1ccc(NC(=O)c2cc(S(=O)(=O)N(C)C)ccc2N2CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C22H29N3O5S/c1-24(2)31(27,28)17-9-11-20(25-12-6-5-7-13-25)18(15-17)22(26)23-19-10-8-16(29-3)14-21(19)30-4/h8-11,14-15H,5-7,12-13H2,1-4H3,(H,23,26) |
| InChIKey | PTSPRKPRPOMTTJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |