C23H26N4O5S — CID 135901470
(4-oxo-3H-quinazolin-2-yl)methyl 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate (PubChem CID 135901470) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is (4-oxo-3H-quinazolin-2-yl)methyl 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate.
| Compound Name | (4-oxo-3H-quinazolin-2-yl)methyl 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 135901470 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | (4-oxo-3H-quinazolin-2-yl)methyl 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCCCC2)c(C(=O)OCc2nc3ccccc3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C23H26N4O5S/c1-26(2)33(30,31)16-10-11-20(27-12-6-3-7-13-27)18(14-16)23(29)32-15-21-24-19-9-5-4-8-17(19)22(28)25-21/h4-5,8-11,14H,3,6-7,12-13,15H2,1-2H3,(H,24,25,28) |
| InChIKey | AICWBBVCPMJRQJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 112.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |