C22H27N3O5S — CID 55634329
(3-carbamoylphenyl)methyl 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate (PubChem CID 55634329) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is (3-carbamoylphenyl)methyl 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate.
| Compound Name | (3-carbamoylphenyl)methyl 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 55634329 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (3-carbamoylphenyl)methyl 5-(dimethylsulfamoyl)-2-piperidin-1-ylbenzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCCCC2)c(C(=O)OCc2cccc(C(N)=O)c2)c1 |
| InChI | InChI=1S/C22H27N3O5S/c1-24(2)31(28,29)18-9-10-20(25-11-4-3-5-12-25)19(14-18)22(27)30-15-16-7-6-8-17(13-16)21(23)26/h6-10,13-14H,3-5,11-12,15H2,1-2H3,(H2,23,26) |
| InChIKey | MAIAASGXSBRIGH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |