C24H18ClNO6S — CID 4834337
[3-(dimethylsulfamoyl)phenyl]methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 4834337) has the molecular formula C24H18ClNO6S and a molecular weight of 483.93 g/mol. Its IUPAC name is [3-(dimethylsulfamoyl)phenyl]methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [3-(dimethylsulfamoyl)phenyl]methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 4834337 |
| Molecular Formula | C24H18ClNO6S |
| Molecular Weight | 483.93 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | [3-(dimethylsulfamoyl)phenyl]methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CN(C)S(=O)(=O)c1cccc(COC(=O)c2ccc3c(c2Cl)C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C24H18ClNO6S/c1-26(2)33(30,31)15-7-5-6-14(12-15)13-32-24(29)19-11-10-18-20(21(19)25)23(28)17-9-4-3-8-16(17)22(18)27/h3-12H,13H2,1-2H3 |
| InChIKey | FZQKBQKXFLNTON-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.93 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|