C18H16ClNO4S2 — CID 2128174
[3-(dimethylsulfamoyl)phenyl]methyl 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 2128174) has the molecular formula C18H16ClNO4S2 and a molecular weight of 409.92 g/mol. Its IUPAC name is [3-(dimethylsulfamoyl)phenyl]methyl 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [3-(dimethylsulfamoyl)phenyl]methyl 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 2128174 |
| Molecular Formula | C18H16ClNO4S2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | [3-(dimethylsulfamoyl)phenyl]methyl 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | CN(C)S(=O)(=O)c1cccc(COC(=O)c2sc3ccccc3c2Cl)c1 |
| InChI | InChI=1S/C18H16ClNO4S2/c1-20(2)26(22,23)13-7-5-6-12(10-13)11-24-18(21)17-16(19)14-8-3-4-9-15(14)25-17/h3-10H,11H2,1-2H3 |
| InChIKey | VYCYRVSHEOMWGO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |