C21H22ClN3O4S — CID 2508289
[3-(dimethylsulfamoyl)phenyl]methyl 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate (PubChem CID 2508289) has the molecular formula C21H22ClN3O4S and a molecular weight of 447.94 g/mol. Its IUPAC name is [3-(dimethylsulfamoyl)phenyl]methyl 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate.
| Compound Name | [3-(dimethylsulfamoyl)phenyl]methyl 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2508289 |
| Molecular Formula | C21H22ClN3O4S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [3-(dimethylsulfamoyl)phenyl]methyl 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1C(=O)OCc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C21H22ClN3O4S/c1-15-19(20(22)25(23-15)13-16-8-5-4-6-9-16)21(26)29-14-17-10-7-11-18(12-17)30(27,28)24(2)3/h4-12H,13-14H2,1-3H3 |
| InChIKey | CLRCROQZWIABPM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |