C17H20N2O7S2 — CID 55730614
[5-(dimethylsulfamoyl)furan-2-yl]methyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate (PubChem CID 55730614) has the molecular formula C17H20N2O7S2 and a molecular weight of 428.49 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate.
| Compound Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 55730614 |
| Molecular Formula | C17H20N2O7S2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
| SMILES | CN(C)S(=O)(=O)c1ccc(COC(=O)CNS(=O)(=O)/C=C/c2ccccc2)o1 |
| InChI | InChI=1S/C17H20N2O7S2/c1-19(2)28(23,24)17-9-8-15(26-17)13-25-16(20)12-18-27(21,22)11-10-14-6-4-3-5-7-14/h3-11,18H,12-13H2,1-2H3/b11-10+ |
| InChIKey | KXIOVDVCIDSFLE-ZHACJKMWSA-N |
| XLogP | 1.16 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |