C11H15N3O3S2 — CID 106039792
5-[[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]methyl]furan-2-sulfonamide (PubChem CID 106039792) has the molecular formula C11H15N3O3S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 5-[[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]methyl]furan-2-sulfonamide.
| Compound Name | 5-[[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]methyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 106039792 |
| Molecular Formula | C11H15N3O3S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 5-[[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]methyl]furan-2-sulfonamide |
| SMILES | Cc1nc(CCNCc2ccc(S(N)(=O)=O)o2)cs1 |
| InChI | InChI=1S/C11H15N3O3S2/c1-8-14-9(7-18-8)4-5-13-6-10-2-3-11(17-10)19(12,15)16/h2-3,7,13H,4-6H2,1H3,(H2,12,15,16) |
| InChIKey | VKPXDTCSZNNGEQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|