C8H14N2O4S — CID 64580129
2-[[5-(hydroxymethyl)furan-2-yl]methylamino]ethanesulfonamide (PubChem CID 64580129) has the molecular formula C8H14N2O4S and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-[[5-(hydroxymethyl)furan-2-yl]methylamino]ethanesulfonamide.
| Compound Name | 2-[[5-(hydroxymethyl)furan-2-yl]methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 64580129 |
| Molecular Formula | C8H14N2O4S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-[[5-(hydroxymethyl)furan-2-yl]methylamino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNCc1ccc(CO)o1 |
| InChI | InChI=1S/C8H14N2O4S/c9-15(12,13)4-3-10-5-7-1-2-8(6-11)14-7/h1-2,10-11H,3-6H2,(H2,9,12,13) |
| InChIKey | NAWDGSIGLWKWOA-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|