C9H14N2O5S — CID 104608224
methyl 5-[(2-sulfamoylethylamino)methyl]furan-3-carboxylate (PubChem CID 104608224) has the molecular formula C9H14N2O5S and a molecular weight of 262.29 g/mol. Its IUPAC name is methyl 5-[(2-sulfamoylethylamino)methyl]furan-3-carboxylate.
| Compound Name | methyl 5-[(2-sulfamoylethylamino)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 104608224 |
| Molecular Formula | C9H14N2O5S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | methyl 5-[(2-sulfamoylethylamino)methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1coc(CNCCS(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H14N2O5S/c1-15-9(12)7-4-8(16-6-7)5-11-2-3-17(10,13)14/h4,6,11H,2-3,5H2,1H3,(H2,10,13,14) |
| InChIKey | VSDHCAODCKZRKC-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|