C13H15NO3S — CID 104585912
methyl 5-[(2-thiophen-3-ylethylamino)methyl]furan-3-carboxylate (PubChem CID 104585912) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is methyl 5-[(2-thiophen-3-ylethylamino)methyl]furan-3-carboxylate.
| Compound Name | methyl 5-[(2-thiophen-3-ylethylamino)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 104585912 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | methyl 5-[(2-thiophen-3-ylethylamino)methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1coc(CNCCc2ccsc2)c1 |
| InChI | InChI=1S/C13H15NO3S/c1-16-13(15)11-6-12(17-8-11)7-14-4-2-10-3-5-18-9-10/h3,5-6,8-9,14H,2,4,7H2,1H3 |
| InChIKey | ZIIZZTLRINIZPH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|