C10H12N2O3 — CID 104608135
methyl 5-[(2-cyanoethylamino)methyl]furan-3-carboxylate (PubChem CID 104608135) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is methyl 5-[(2-cyanoethylamino)methyl]furan-3-carboxylate.
| Compound Name | methyl 5-[(2-cyanoethylamino)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 104608135 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | methyl 5-[(2-cyanoethylamino)methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1coc(CNCCC#N)c1 |
| InChI | InChI=1S/C10H12N2O3/c1-14-10(13)8-5-9(15-7-8)6-12-4-2-3-11/h5,7,12H,2,4,6H2,1H3 |
| InChIKey | QHXDHRSQYURREW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|