C11H18N2O5S — CID 104586193
methyl 5-[[2-(ethylsulfamoyl)ethylamino]methyl]furan-3-carboxylate (PubChem CID 104586193) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is methyl 5-[[2-(ethylsulfamoyl)ethylamino]methyl]furan-3-carboxylate.
| Compound Name | methyl 5-[[2-(ethylsulfamoyl)ethylamino]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 104586193 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | methyl 5-[[2-(ethylsulfamoyl)ethylamino]methyl]furan-3-carboxylate |
| SMILES | CCNS(=O)(=O)CCNCc1cc(C(=O)OC)co1 |
| InChI | InChI=1S/C11H18N2O5S/c1-3-13-19(15,16)5-4-12-7-10-6-9(8-18-10)11(14)17-2/h6,8,12-13H,3-5,7H2,1-2H3 |
| InChIKey | PWXCQBRNPSAKKV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|