C11H17NO5 — CID 104585806
methyl 5-[[2-(2-hydroxyethoxy)ethylamino]methyl]furan-3-carboxylate (PubChem CID 104585806) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is methyl 5-[[2-(2-hydroxyethoxy)ethylamino]methyl]furan-3-carboxylate.
| Compound Name | methyl 5-[[2-(2-hydroxyethoxy)ethylamino]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 104585806 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | methyl 5-[[2-(2-hydroxyethoxy)ethylamino]methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1coc(CNCCOCCO)c1 |
| InChI | InChI=1S/C11H17NO5/c1-15-11(14)9-6-10(17-8-9)7-12-2-4-16-5-3-13/h6,8,12-13H,2-5,7H2,1H3 |
| InChIKey | FAKCPUUEFFKTPQ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|