C12H18N4O3S — CID 106218501
5-(ethylaminomethyl)-N-[1-(1H-pyrazol-4-yl)ethyl]furan-2-sulfonamide (PubChem CID 106218501) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N-[1-(1H-pyrazol-4-yl)ethyl]furan-2-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-N-[1-(1H-pyrazol-4-yl)ethyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 106218501 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 5-(ethylaminomethyl)-N-[1-(1H-pyrazol-4-yl)ethyl]furan-2-sulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NC(C)c2cn[nH]c2)o1 |
| InChI | InChI=1S/C12H18N4O3S/c1-3-13-8-11-4-5-12(19-11)20(17,18)16-9(2)10-6-14-15-7-10/h4-7,9,13,16H,3,8H2,1-2H3,(H,14,15) |
| InChIKey | DNRQVZHUXWLQNZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |