C8H8F3NO4S2 — CID 106433441
5-formyl-N-[2-(trifluoromethylsulfanyl)ethyl]furan-2-sulfonamide (PubChem CID 106433441) has the molecular formula C8H8F3NO4S2 and a molecular weight of 303.28 g/mol. Its IUPAC name is 5-formyl-N-[2-(trifluoromethylsulfanyl)ethyl]furan-2-sulfonamide.
| Compound Name | 5-formyl-N-[2-(trifluoromethylsulfanyl)ethyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 106433441 |
| Molecular Formula | C8H8F3NO4S2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | 5-formyl-N-[2-(trifluoromethylsulfanyl)ethyl]furan-2-sulfonamide |
| SMILES | O=Cc1ccc(S(=O)(=O)NCCSC(F)(F)F)o1 |
| InChI | InChI=1S/C8H8F3NO4S2/c9-8(10,11)17-4-3-12-18(14,15)7-2-1-6(5-13)16-7/h1-2,5,12H,3-4H2 |
| InChIKey | MOQKPWOZJWMZLT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|