C10H15NO6S — CID 114172010
5-formyl-N-[3-(2-hydroxyethoxy)propyl]furan-2-sulfonamide (PubChem CID 114172010) has the molecular formula C10H15NO6S and a molecular weight of 277.30 g/mol. Its IUPAC name is 5-formyl-N-[3-(2-hydroxyethoxy)propyl]furan-2-sulfonamide.
| Compound Name | 5-formyl-N-[3-(2-hydroxyethoxy)propyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 114172010 |
| Molecular Formula | C10H15NO6S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 5-formyl-N-[3-(2-hydroxyethoxy)propyl]furan-2-sulfonamide |
| SMILES | O=Cc1ccc(S(=O)(=O)NCCCOCCO)o1 |
| InChI | InChI=1S/C10H15NO6S/c12-5-7-16-6-1-4-11-18(14,15)10-3-2-9(8-13)17-10/h2-3,8,11-12H,1,4-7H2 |
| InChIKey | FEAKUSINEOVWMZ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|