C13H19NO5S — CID 103968565
5-formyl-N-[[1-(hydroxymethyl)cyclohexyl]methyl]furan-2-sulfonamide (PubChem CID 103968565) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 5-formyl-N-[[1-(hydroxymethyl)cyclohexyl]methyl]furan-2-sulfonamide.
| Compound Name | 5-formyl-N-[[1-(hydroxymethyl)cyclohexyl]methyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 103968565 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 5-formyl-N-[[1-(hydroxymethyl)cyclohexyl]methyl]furan-2-sulfonamide |
| SMILES | O=Cc1ccc(S(=O)(=O)NCC2(CO)CCCCC2)o1 |
| InChI | InChI=1S/C13H19NO5S/c15-8-11-4-5-12(19-11)20(17,18)14-9-13(10-16)6-2-1-3-7-13/h4-5,8,14,16H,1-3,6-7,9-10H2 |
| InChIKey | LVFQSJNSUNCYQY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|