C11H15NO5S — CID 114148606
5-formyl-N-[(3-hydroxycyclopentyl)methyl]furan-2-sulfonamide (PubChem CID 114148606) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is 5-formyl-N-[(3-hydroxycyclopentyl)methyl]furan-2-sulfonamide.
| Compound Name | 5-formyl-N-[(3-hydroxycyclopentyl)methyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 114148606 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 5-formyl-N-[(3-hydroxycyclopentyl)methyl]furan-2-sulfonamide |
| SMILES | O=Cc1ccc(S(=O)(=O)NCC2CCC(O)C2)o1 |
| InChI | InChI=1S/C11H15NO5S/c13-7-10-3-4-11(17-10)18(15,16)12-6-8-1-2-9(14)5-8/h3-4,7-9,12,14H,1-2,5-6H2 |
| InChIKey | NEPMLAMJERINEY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|