C8H7F4NO4S — CID 106295742
5-formyl-N-(2,2,3,3-tetrafluoropropyl)furan-2-sulfonamide (PubChem CID 106295742) has the molecular formula C8H7F4NO4S and a molecular weight of 289.21 g/mol. Its IUPAC name is 5-formyl-N-(2,2,3,3-tetrafluoropropyl)furan-2-sulfonamide.
| Compound Name | 5-formyl-N-(2,2,3,3-tetrafluoropropyl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 106295742 |
| Molecular Formula | C8H7F4NO4S |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 5-formyl-N-(2,2,3,3-tetrafluoropropyl)furan-2-sulfonamide |
| SMILES | O=Cc1ccc(S(=O)(=O)NCC(F)(F)C(F)F)o1 |
| InChI | InChI=1S/C8H7F4NO4S/c9-7(10)8(11,12)4-13-18(15,16)6-2-1-5(3-14)17-6/h1-3,7,13H,4H2 |
| InChIKey | YEMSYQGEXTUYIH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|